C23H36O2 — CID 135033184
(1'R,2'S,7'S,10'S,14'S)-2',6',6',12'-tetramethyl-15'-methylidenespiro[1,3-dioxolane-2,13'-tetracyclo[8.6.0.01,14.02,7]hexadecane] (PubChem CID 135033184) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (1'R,2'S,7'S,10'S,14'S)-2',6',6',12'-tetramethyl-15'-methylidenespiro[1,3-dioxolane-2,13'-tetracyclo[8.6.0.01,14.02,7]hexadecane].
| Compound Name | (1'R,2'S,7'S,10'S,14'S)-2',6',6',12'-tetramethyl-15'-methylidenespiro[1,3-dioxolane-2,13'-tetracyclo[8.6.0.01,14.02,7]hexadecane] |
|---|---|
| PubChem CID | 135033184 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (1'R,2'S,7'S,10'S,14'S)-2',6',6',12'-tetramethyl-15'-methylidenespiro[1,3-dioxolane-2,13'-tetracyclo[8.6.0.01,14.02,7]hexadecane] |
| SMILES | C=C1C[C@]23[C@@H](CC[C@H]4C(C)(C)CCC[C@@]42C)CC(C)C2(OCCO2)[C@@H]13 |
| InChI | InChI=1S/C23H36O2/c1-15-14-22-17(13-16(2)23(19(15)22)24-11-12-25-23)7-8-18-20(3,4)9-6-10-21(18,22)5/h16-19H,1,6-14H2,2-5H3/t16?,17-,18-,19-,21-,22+/m0/s1 |
| InChIKey | KFIRJCIJJUFXFU-BDMXUCKVSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|