C26H44O2Si — CID 71608620
(1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one (PubChem CID 71608620) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one.
| Compound Name | (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one |
|---|---|
| PubChem CID | 71608620 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (1R,2S,6S,7R,10S,14S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethyl-15-methylidenetetracyclo[8.6.0.01,14.02,7]hexadecan-13-one |
| SMILES | C=C1C[C@@]23[C@H](CCC(=O)[C@@H]12)CC[C@H]1[C@@](C)(CO[Si](C)(C)C(C)(C)C)CCC[C@@]13C |
| InChI | InChI=1S/C26H44O2Si/c1-18-16-26-19(10-12-20(27)22(18)26)11-13-21-24(5,14-9-15-25(21,26)6)17-28-29(7,8)23(2,3)4/h19,21-22H,1,9-17H2,2-8H3/t19-,21+,22-,24-,25+,26-/m1/s1 |
| InChIKey | VEHGUAKSFDIDAC-JUQGDMHTSA-N |
| XLogP | 7.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|