C16H26 — CID 134978722
(1S,2S,5S)-2-hept-2-ynyl-6,6-dimethylbicyclo[3.1.1]heptane (PubChem CID 134978722) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (1S,2S,5S)-2-hept-2-ynyl-6,6-dimethylbicyclo[3.1.1]heptane.
| Compound Name | (1S,2S,5S)-2-hept-2-ynyl-6,6-dimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 134978722 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (1S,2S,5S)-2-hept-2-ynyl-6,6-dimethylbicyclo[3.1.1]heptane |
| SMILES | CCCCC#CC[C@@H]1CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C16H26/c1-4-5-6-7-8-9-13-10-11-14-12-15(13)16(14,2)3/h13-15H,4-6,9-12H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | IKJNOJDIHIDAJR-ILXRZTDVSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|