C14H28O2 — CID 134979482
(E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene (PubChem CID 134979482) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene.
| Compound Name | (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene |
|---|---|
| PubChem CID | 134979482 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene |
| SMILES | CCCCC/C=C/C(OCOC)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-6-7-8-9-10-11-13(14(2,3)4)16-12-15-5/h10-11,13H,6-9,12H2,1-5H3/b11-10+ |
| InChIKey | FLKCRJJFSLHDSH-ZHACJKMWSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|