About (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene
(E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene (PubChem CID 134979482) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene.
Molecular Properties
| Compound Name | (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene |
| PubChem CID | 134979482 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene |
| SMILES | CCCCC/C=C/C(OCOC)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-6-7-8-9-10-11-13(14(2,3)4)16-12-15-5/h10-11,13H,6-9,12H2,1-5H3/b11-10+ |
| InChIKey | FLKCRJJFSLHDSH-ZHACJKMWSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene?
The IUPAC name of (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene (CID 134979482) is (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene.
What is the SMILES notation for (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene?
The canonical SMILES for (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene is CCCCC/C=C/C(OCOC)C(C)(C)C.
What is the InChIKey of (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene?
The InChIKey is FLKCRJJFSLHDSH-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H28O2/c1-6-7-8-9-10-11-13(14(2,3)4)16-12-15-5/h10-11,13H,6-9,12H2,1-5H3/b11-10+.
What are the key properties of (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene?
(E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene has a molecular weight of 228.38 g/mol, XLogP of 4.16, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(methoxymethoxy)-2,2-dimethyldec-4-ene is sourced from PubChem (CID 134979482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).