C13H22O4Si — CID 134980171
[(2E)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate (PubChem CID 134980171) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is [(2E)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate.
| Compound Name | [(2E)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 134980171 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(2E)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate |
| SMILES | C=C(COC(C)=O)/C(=C\COC(C)=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H22O4Si/c1-10(9-17-12(3)15)13(18(4,5)6)7-8-16-11(2)14/h7H,1,8-9H2,2-6H3/b13-7+ |
| InChIKey | QUJGDDPYSMPCNF-NTUHNPAUSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|