C23H28O5 — CID 134980224
diethyl 5-ethoxy-7-phenyl-1,3,4,5-tetrahydroindene-2,2-dicarboxylate (PubChem CID 134980224) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is diethyl 5-ethoxy-7-phenyl-1,3,4,5-tetrahydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5-ethoxy-7-phenyl-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134980224 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | diethyl 5-ethoxy-7-phenyl-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C1)C(c1ccccc1)=CC(OCC)C2 |
| InChI | InChI=1S/C23H28O5/c1-4-26-18-12-17-14-23(21(24)27-5-2,22(25)28-6-3)15-20(17)19(13-18)16-10-8-7-9-11-16/h7-11,13,18H,4-6,12,14-15H2,1-3H3 |
| InChIKey | IHYOHZBWBPKSQV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|