C9H11ClO2 — CID 134980987
(3Z,4S,5S)-3-(1-chloroethylidene)-4-ethenyl-5-methyloxolan-2-one (PubChem CID 134980987) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is (3Z,4S,5S)-3-(1-chloroethylidene)-4-ethenyl-5-methyloxolan-2-one.
| Compound Name | (3Z,4S,5S)-3-(1-chloroethylidene)-4-ethenyl-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 134980987 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (3Z,4S,5S)-3-(1-chloroethylidene)-4-ethenyl-5-methyloxolan-2-one |
| SMILES | C=C[C@H]1/C(=C(\C)Cl)C(=O)O[C@H]1C |
| InChI | InChI=1S/C9H11ClO2/c1-4-7-6(3)12-9(11)8(7)5(2)10/h4,6-7H,1H2,2-3H3/b8-5-/t6-,7+/m0/s1 |
| InChIKey | JSHGVSZHDWBITR-UCWTYMPZSA-N |
| XLogP | 2.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|