C15H20O3 — CID 73154518
4-(3,7-dimethyl-5-oxoocta-2,6-dienyl)-3-methylideneoxolan-2-one (PubChem CID 73154518) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-(3,7-dimethyl-5-oxoocta-2,6-dienyl)-3-methylideneoxolan-2-one.
| Compound Name | 4-(3,7-dimethyl-5-oxoocta-2,6-dienyl)-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 73154518 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(3,7-dimethyl-5-oxoocta-2,6-dienyl)-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)OCC1CC=C(C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C15H20O3/c1-10(2)7-14(16)8-11(3)5-6-13-9-18-15(17)12(13)4/h5,7,13H,4,6,8-9H2,1-3H3 |
| InChIKey | WSKLYRKBPFVGEJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|