C13H20O3 — CID 134981023
ethyl (2E)-2-[5-ethyl-5-[(E)-prop-1-enyl]oxolan-2-ylidene]acetate (PubChem CID 134981023) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl (2E)-2-[5-ethyl-5-[(E)-prop-1-enyl]oxolan-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[5-ethyl-5-[(E)-prop-1-enyl]oxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 134981023 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethyl (2E)-2-[5-ethyl-5-[(E)-prop-1-enyl]oxolan-2-ylidene]acetate |
| SMILES | C/C=C/C1(CC)CC/C(=C\C(=O)OCC)O1 |
| InChI | InChI=1S/C13H20O3/c1-4-8-13(5-2)9-7-11(16-13)10-12(14)15-6-3/h4,8,10H,5-7,9H2,1-3H3/b8-4+,11-10+ |
| InChIKey | OYNOMGHMBHFWGU-IBYINHFXSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|