C7H18O3Si — CID 134981325
(1R,2R)-2-methyl-1-trimethylsilylpropane-1,2,3-triol (PubChem CID 134981325) has the molecular formula C7H18O3Si and a molecular weight of 178.30 g/mol. Its IUPAC name is (1R,2R)-2-methyl-1-trimethylsilylpropane-1,2,3-triol.
| Compound Name | (1R,2R)-2-methyl-1-trimethylsilylpropane-1,2,3-triol |
|---|---|
| PubChem CID | 134981325 |
| Molecular Formula | C7H18O3Si |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1R,2R)-2-methyl-1-trimethylsilylpropane-1,2,3-triol |
| SMILES | C[C@@](O)(CO)[C@H](O)[Si](C)(C)C |
| InChI | InChI=1S/C7H18O3Si/c1-7(10,5-8)6(9)11(2,3)4/h6,8-10H,5H2,1-4H3/t6-,7-/m1/s1 |
| InChIKey | DNFNZZAUCLKLHK-RNFRBKRXSA-N |
| XLogP | -0.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|