C15H16O3 — CID 134981334
cis-(2R,3S)-3-acetyl-5-methylidene-2-phenylcyclopentane-1-carboxylic acid (PubChem CID 134981334) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is cis-(2R,3S)-3-acetyl-5-methylidene-2-phenylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(2R,3S)-3-acetyl-5-methylidene-2-phenylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 134981334 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | cis-(2R,3S)-3-acetyl-5-methylidene-2-phenylcyclopentane-1-carboxylic acid |
| SMILES | C=C1C[C@H](C(C)=O)[C@@H](c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C15H16O3/c1-9-8-12(10(2)16)14(13(9)15(17)18)11-6-4-3-5-7-11/h3-7,12-14H,1,8H2,2H3,(H,17,18)/t12-,13?,14-/m1/s1 |
| InChIKey | VZQIEYNQGOYWBP-WYAMFQBQSA-N |
| XLogP | 2.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|