C11H18O — CID 134981827
4-ethylnona-1,4,5-trien-3-ol (PubChem CID 134981827) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-ethylnona-1,4,5-trien-3-ol.
| Compound Name | 4-ethylnona-1,4,5-trien-3-ol |
|---|---|
| PubChem CID | 134981827 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-ethylnona-1,4,5-trien-3-ol |
| SMILES | C=CC(O)C(=C=CCCC)CC |
| InChI | InChI=1S/C11H18O/c1-4-7-8-9-10(5-2)11(12)6-3/h6,8,11-12H,3-5,7H2,1-2H3 |
| InChIKey | CNYZOAQDFAAZAK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|