C22H31NO4 — CID 134981868
tert-butyl (2Z,4E)-3-(diethylcarbamoyl)-6-phenylmethoxyhexa-2,4-dienoate (PubChem CID 134981868) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl (2Z,4E)-3-(diethylcarbamoyl)-6-phenylmethoxyhexa-2,4-dienoate.
| Compound Name | tert-butyl (2Z,4E)-3-(diethylcarbamoyl)-6-phenylmethoxyhexa-2,4-dienoate |
|---|---|
| PubChem CID | 134981868 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl (2Z,4E)-3-(diethylcarbamoyl)-6-phenylmethoxyhexa-2,4-dienoate |
| SMILES | CCN(CC)C(=O)C(=C\C(=O)OC(C)(C)C)/C=C/COCc1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c1-6-23(7-2)21(25)19(16-20(24)27-22(3,4)5)14-11-15-26-17-18-12-9-8-10-13-18/h8-14,16H,6-7,15,17H2,1-5H3/b14-11+,19-16- |
| InChIKey | VNBCGRCLVWHCKG-PSTUDBSHSA-N |
| XLogP | 3.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|