C22H29I2NO4 — CID 134981874
tert-butyl (2E,4Z)-3-(diethylcarbamoyl)-2,5-diiodo-6-phenylmethoxyhexa-2,4-dienoate (PubChem CID 134981874) has the molecular formula C22H29I2NO4 and a molecular weight of 625.29 g/mol. Its IUPAC name is tert-butyl (2E,4Z)-3-(diethylcarbamoyl)-2,5-diiodo-6-phenylmethoxyhexa-2,4-dienoate.
| Compound Name | tert-butyl (2E,4Z)-3-(diethylcarbamoyl)-2,5-diiodo-6-phenylmethoxyhexa-2,4-dienoate |
|---|---|
| PubChem CID | 134981874 |
| Molecular Formula | C22H29I2NO4 |
| Molecular Weight | 625.29 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | tert-butyl (2E,4Z)-3-(diethylcarbamoyl)-2,5-diiodo-6-phenylmethoxyhexa-2,4-dienoate |
| SMILES | CCN(CC)C(=O)C(/C=C(\I)COCc1ccccc1)=C(/I)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29I2NO4/c1-6-25(7-2)20(26)18(19(24)21(27)29-22(3,4)5)13-17(23)15-28-14-16-11-9-8-10-12-16/h8-13H,6-7,14-15H2,1-5H3/b17-13-,19-18+ |
| InChIKey | LGYRSDKUJBKNQP-ILMMDERFSA-N |
| XLogP | 5.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|