About 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium
2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium (PubChem CID 134981946) has the molecular formula C15H26Cl4NOTi
and a molecular weight of 426.06 g/mol. Its IUPAC name is 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium |
| PubChem CID | 134981946 |
| Molecular Formula | C15H26Cl4NOTi |
| Molecular Weight | 426.06 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium |
| SMILES | CC(C)(C)C1=CC(Cl)C(C(C)(C)C)=NC=C1.CO.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C14H22ClN.CH4O.3ClH.Ti/c1-13(2,3)10-7-8-16-12(11(15)9-10)14(4,5)6;1-2;;;;/h7-9,11H,1-6H3;2H,1H3;3*1H;/q;;;;;+3/p-3 |
| InChIKey | KJQKOQDOPJUBMM-UHFFFAOYSA-K |
| XLogP | 6.26 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.06 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium?
The IUPAC name of 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium (CID 134981946) is 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium.
What is the SMILES notation for 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium?
The canonical SMILES for 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium is CC(C)(C)C1=CC(Cl)C(C(C)(C)C)=NC=C1.CO.Cl[Ti](Cl)Cl.
What is the InChIKey of 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium?
The InChIKey is KJQKOQDOPJUBMM-UHFFFAOYSA-K. The full InChI is InChI=1S/C14H22ClN.CH4O.3ClH.Ti/c1-13(2,3)10-7-8-16-12(11(15)9-10)14(4,5)6;1-2;;;;/h7-9,11H,1-6H3;2H,1H3;3*1H;/q;;;;;+3/p-3.
What are the key properties of 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium?
2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium has a molecular weight of 426.06 g/mol, XLogP of 6.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-3-chloro-3H-azepine;methanol;trichlorotitanium is sourced from PubChem (CID 134981946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).