C14H22ClN — CID 134981947
2,5-ditert-butyl-3-chloro-3H-azepine (PubChem CID 134981947) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 2,5-ditert-butyl-3-chloro-3H-azepine.
| Compound Name | 2,5-ditert-butyl-3-chloro-3H-azepine |
|---|---|
| PubChem CID | 134981947 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2,5-ditert-butyl-3-chloro-3H-azepine |
| SMILES | CC(C)(C)C1=CC(Cl)C(C(C)(C)C)=NC=C1 |
| InChI | InChI=1S/C14H22ClN/c1-13(2,3)10-7-8-16-12(11(15)9-10)14(4,5)6/h7-9,11H,1-6H3 |
| InChIKey | HXFWLXNNECNGJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|