C14H20O5 — CID 134982179
methyl 4-[(2R,3R)-3-[(1E,3E)-5-acetyloxypenta-1,3-dienyl]oxiran-2-yl]butanoate (PubChem CID 134982179) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 4-[(2R,3R)-3-[(1E,3E)-5-acetyloxypenta-1,3-dienyl]oxiran-2-yl]butanoate.
| Compound Name | methyl 4-[(2R,3R)-3-[(1E,3E)-5-acetyloxypenta-1,3-dienyl]oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 134982179 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 4-[(2R,3R)-3-[(1E,3E)-5-acetyloxypenta-1,3-dienyl]oxiran-2-yl]butanoate |
| SMILES | COC(=O)CCC[C@H]1O[C@@H]1/C=C/C=C/COC(C)=O |
| InChI | InChI=1S/C14H20O5/c1-11(15)18-10-5-3-4-7-12-13(19-12)8-6-9-14(16)17-2/h3-5,7,12-13H,6,8-10H2,1-2H3/b5-3+,7-4+/t12-,13-/m1/s1 |
| InChIKey | KVMRFXYSGMESLH-KKMILRPTSA-N |
| XLogP | 1.77 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|