C16H26O — CID 134982293
(1Z,3S,4R,7R,8S,11S)-4,8-dimethyltricyclo[9.3.0.03,7]tetradec-1-en-9-ol (PubChem CID 134982293) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1Z,3S,4R,7R,8S,11S)-4,8-dimethyltricyclo[9.3.0.03,7]tetradec-1-en-9-ol.
| Compound Name | (1Z,3S,4R,7R,8S,11S)-4,8-dimethyltricyclo[9.3.0.03,7]tetradec-1-en-9-ol |
|---|---|
| PubChem CID | 134982293 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1Z,3S,4R,7R,8S,11S)-4,8-dimethyltricyclo[9.3.0.03,7]tetradec-1-en-9-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]1/C=C1/CCC[C@H]1CC(O)[C@H]2C |
| InChI | InChI=1S/C16H26O/c1-10-6-7-14-11(2)16(17)9-13-5-3-4-12(13)8-15(10)14/h8,10-11,13-17H,3-7,9H2,1-2H3/b12-8-/t10-,11+,13+,14+,15+,16?/m1/s1 |
| InChIKey | MHCZAJRTFCMADN-YZURXNODSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|