C16H24O2 — CID 134982448
1-ethyl-6-methoxy-2,2,3,3-tetramethyl-1H-inden-5-ol (PubChem CID 134982448) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-ethyl-6-methoxy-2,2,3,3-tetramethyl-1H-inden-5-ol.
| Compound Name | 1-ethyl-6-methoxy-2,2,3,3-tetramethyl-1H-inden-5-ol |
|---|---|
| PubChem CID | 134982448 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-ethyl-6-methoxy-2,2,3,3-tetramethyl-1H-inden-5-ol |
| SMILES | CCC1c2cc(OC)c(O)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H24O2/c1-7-11-10-8-14(18-6)13(17)9-12(10)16(4,5)15(11,2)3/h8-9,11,17H,7H2,1-6H3 |
| InChIKey | WJBLBVVDYZKDGH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |