C22H28N2O2S2 — CID 13498247
5-[4-(3-hydroxypropyl)piperazin-1-yl]-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-8-ol (PubChem CID 13498247) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is 5-[4-(3-hydroxypropyl)piperazin-1-yl]-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-8-ol.
| Compound Name | 5-[4-(3-hydroxypropyl)piperazin-1-yl]-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-8-ol |
|---|---|
| PubChem CID | 13498247 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[4-(3-hydroxypropyl)piperazin-1-yl]-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-8-ol |
| SMILES | CSc1ccc2c(c1)C(N1CCN(CCCO)CC1)Cc1cc(O)ccc1S2 |
| InChI | InChI=1S/C22H28N2O2S2/c1-27-18-4-6-22-19(15-18)20(14-16-13-17(26)3-5-21(16)28-22)24-10-8-23(9-11-24)7-2-12-25/h3-6,13,15,20,25-26H,2,7-12,14H2,1H3 |
| InChIKey | KFFASHKYKUKMFH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|