C31H62O6Si3 — CID 134982504
trimethylsilyl (6E,8E,10S,13R)-15-[tert-butyl(dimethyl)silyl]oxy-10-methyl-3-oxo-13-(2-trimethylsilylethoxymethoxy)pentadeca-6,8-dienoate (PubChem CID 134982504) has the molecular formula C31H62O6Si3 and a molecular weight of 615.09 g/mol. Its IUPAC name is trimethylsilyl (6E,8E,10S,13R)-15-[tert-butyl(dimethyl)silyl]oxy-10-methyl-3-oxo-13-(2-trimethylsilylethoxymethoxy)pentadeca-6,8-dienoate.
| Compound Name | trimethylsilyl (6E,8E,10S,13R)-15-[tert-butyl(dimethyl)silyl]oxy-10-methyl-3-oxo-13-(2-trimethylsilylethoxymethoxy)pentadeca-6,8-dienoate |
|---|---|
| PubChem CID | 134982504 |
| Molecular Formula | C31H62O6Si3 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.39 |
| IUPAC Name | trimethylsilyl (6E,8E,10S,13R)-15-[tert-butyl(dimethyl)silyl]oxy-10-methyl-3-oxo-13-(2-trimethylsilylethoxymethoxy)pentadeca-6,8-dienoate |
| SMILES | C[C@H](/C=C/C=C/CCC(=O)CC(=O)O[Si](C)(C)C)CC[C@H](CCO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C31H62O6Si3/c1-27(17-15-13-14-16-18-28(32)25-30(33)37-39(8,9)10)19-20-29(35-26-34-23-24-38(5,6)7)21-22-36-40(11,12)31(2,3)4/h13-15,17,27,29H,16,18-26H2,1-12H3/b14-13+,17-15+/t27-,29-/m1/s1 |
| InChIKey | XSBXDEZMFPGUOQ-WVQJBJICSA-N |
| XLogP | 8.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|