C70H74Br2 — CID 134983148
9-bromo-4-[(E)-2-(9-bromo-1,11,13-tritert-butylpicen-4-yl)ethenyl]-1,11,13-tritert-butylpicene (PubChem CID 134983148) has the molecular formula C70H74Br2 and a molecular weight of 1075.17 g/mol. Its IUPAC name is 9-bromo-4-[(E)-2-(9-bromo-1,11,13-tritert-butylpicen-4-yl)ethenyl]-1,11,13-tritert-butylpicene.
| Compound Name | 9-bromo-4-[(E)-2-(9-bromo-1,11,13-tritert-butylpicen-4-yl)ethenyl]-1,11,13-tritert-butylpicene |
|---|---|
| PubChem CID | 134983148 |
| Molecular Formula | C70H74Br2 |
| Molecular Weight | 1075.17 g/mol |
| Exact Mass | 1072.42 |
| IUPAC Name | 9-bromo-4-[(E)-2-(9-bromo-1,11,13-tritert-butylpicen-4-yl)ethenyl]-1,11,13-tritert-butylpicene |
| SMILES | CC(C)(C)c1cc(Br)c2ccc3c4ccc5c(/C=C/c6ccc(C(C)(C)C)c7c6ccc6c7cc(C(C)(C)C)c7c8cc(C(C)(C)C)cc(Br)c8ccc67)ccc(C(C)(C)C)c5c4cc(C(C)(C)C)c3c2c1 |
| InChI | InChI=1S/C70H74Br2/c1-65(2,3)41-33-51-47(59(71)35-41)27-29-49-45-25-23-43-39(21-31-55(67(7,8)9)61(43)53(45)37-57(63(49)51)69(13,14)15)19-20-40-22-32-56(68(10,11)12)62-44(40)24-26-46-50-30-28-48-52(34-42(36-60(48)72)66(4,5)6)64(50)58(38-54(46)62)70(16,17)18/h19-38H,1-18H3/b20-19+ |
| InChIKey | VYVZERHQKNTTQW-FMQUCBEESA-N |
| XLogP | 22.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.17 |
| LogP ≤ 5 | 22.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|