C30H27NO2 — CID 134983760
benzyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate (PubChem CID 134983760) has the molecular formula C30H27NO2 and a molecular weight of 433.55 g/mol. Its IUPAC name is benzyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate.
| Compound Name | benzyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134983760 |
| Molecular Formula | C30H27NO2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | benzyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OCc2ccccc2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO2/c1-23-28(29(32)33-22-24-14-6-2-7-15-24)31(23)30(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,23,28H,22H2,1H3/t23-,28+,31?/m1/s1 |
| InChIKey | MATRDGUUKSDIHC-YWYHAMLFSA-N |
| XLogP | 5.79 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|