C25H23NO3 — CID 134983902
ethyl (2R,3S)-1-benzhydryl-3-benzoylaziridine-2-carboxylate (PubChem CID 134983902) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is ethyl (2R,3S)-1-benzhydryl-3-benzoylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-1-benzhydryl-3-benzoylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134983902 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | ethyl (2R,3S)-1-benzhydryl-3-benzoylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](C(=O)c2ccccc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-2-29-25(28)23-22(24(27)20-16-10-5-11-17-20)26(23)21(18-12-6-3-7-13-18)19-14-8-4-9-15-19/h3-17,21-23H,2H2,1H3/t22-,23+,26?/m0/s1 |
| InChIKey | GQFRDZRBVXRPJY-MXKXXCEUSA-N |
| XLogP | 4.27 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|