C20H20F6N2O — CID 134984304
(4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2,3-bis(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene (PubChem CID 134984304) has the molecular formula C20H20F6N2O and a molecular weight of 418.38 g/mol. Its IUPAC name is (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2,3-bis(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene.
| Compound Name | (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2,3-bis(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene |
|---|---|
| PubChem CID | 134984304 |
| Molecular Formula | C20H20F6N2O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2,3-bis(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene |
| SMILES | COc1ccc([C@H]2CC3=C(C)C(C)(C)[C@H]4C(C(F)(F)F)=C(C(F)(F)F)N2N34)cc1 |
| InChI | InChI=1S/C20H20F6N2O/c1-10-13-9-14(11-5-7-12(29-4)8-6-11)28-17(20(24,25)26)15(19(21,22)23)16(27(13)28)18(10,2)3/h5-8,14,16H,9H2,1-4H3/t14-,16-/m1/s1 |
| InChIKey | ATARJODGEXNLEG-GDBMZVCRSA-N |
| XLogP | 5.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |