C22H32N2O4S2 — CID 134984991
[(1S,2R,4R)-1-(diethylsulfamoyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylsulfanylaziridine-2-carboxylate (PubChem CID 134984991) has the molecular formula C22H32N2O4S2 and a molecular weight of 452.64 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(diethylsulfamoyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylsulfanylaziridine-2-carboxylate.
| Compound Name | [(1S,2R,4R)-1-(diethylsulfamoyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylsulfanylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 134984991 |
| Molecular Formula | C22H32N2O4S2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(1S,2R,4R)-1-(diethylsulfamoyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (2R)-2-phenylsulfanylaziridine-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)[C@]12CC[C@H](C[C@H]1OC(=O)[C@]1(Sc3ccccc3)CN1)C2(C)C |
| InChI | InChI=1S/C22H32N2O4S2/c1-5-24(6-2)30(26,27)21-13-12-16(20(21,3)4)14-18(21)28-19(25)22(15-23-22)29-17-10-8-7-9-11-17/h7-11,16,18,23H,5-6,12-15H2,1-4H3/t16-,18-,21-,22-/m1/s1 |
| InChIKey | ZFZSITRFVDJQFJ-LVOPCWDJSA-N |
| XLogP | 3.24 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|