C23H34N2O4S2 — CID 5249968
[1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenylsulfanylaziridine-2-carboxylate (PubChem CID 5249968) has the molecular formula C23H34N2O4S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is [1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenylsulfanylaziridine-2-carboxylate.
| Compound Name | [1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenylsulfanylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 5249968 |
| Molecular Formula | C23H34N2O4S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [1-(diethylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenylsulfanylaziridine-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)CC12CCC(CC1OC(=O)C1(Sc3ccccc3)CN1)C2(C)C |
| InChI | InChI=1S/C23H34N2O4S2/c1-5-25(6-2)31(27,28)16-22-13-12-17(21(22,3)4)14-19(22)29-20(26)23(15-24-23)30-18-10-8-7-9-11-18/h7-11,17,19,24H,5-6,12-16H2,1-4H3 |
| InChIKey | DDIDQCOJXQMEFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|