C11H17N5O12 — CID 134985224
diethyl 2-[nitro(2,2,2-trinitroethyl)amino]pentanedioate (PubChem CID 134985224) has the molecular formula C11H17N5O12 and a molecular weight of 411.28 g/mol. Its IUPAC name is diethyl 2-[nitro(2,2,2-trinitroethyl)amino]pentanedioate.
| Compound Name | diethyl 2-[nitro(2,2,2-trinitroethyl)amino]pentanedioate |
|---|---|
| PubChem CID | 134985224 |
| Molecular Formula | C11H17N5O12 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | diethyl 2-[nitro(2,2,2-trinitroethyl)amino]pentanedioate |
| SMILES | CCOC(=O)CCC(C(=O)OCC)N(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N5O12/c1-3-27-9(17)6-5-8(10(18)28-4-2)12(16(25)26)7-11(13(19)20,14(21)22)15(23)24/h8H,3-7H2,1-2H3 |
| InChIKey | HLYHVDPTTBNUEY-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 228.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|