C25H31NO6 — CID 134985627
4-nitro-1,7-bis(4-propoxyphenyl)heptane-1,7-dione (PubChem CID 134985627) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 4-nitro-1,7-bis(4-propoxyphenyl)heptane-1,7-dione.
| Compound Name | 4-nitro-1,7-bis(4-propoxyphenyl)heptane-1,7-dione |
|---|---|
| PubChem CID | 134985627 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-nitro-1,7-bis(4-propoxyphenyl)heptane-1,7-dione |
| SMILES | CCCOc1ccc(C(=O)CCC(CCC(=O)c2ccc(OCCC)cc2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H31NO6/c1-3-17-31-22-11-5-19(6-12-22)24(27)15-9-21(26(29)30)10-16-25(28)20-7-13-23(14-8-20)32-18-4-2/h5-8,11-14,21H,3-4,9-10,15-18H2,1-2H3 |
| InChIKey | JUHNPDFESSHADC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|