C10H6ClFN4 — CID 134986557
(2-chloro-4-cyanoimino-5-fluoro-3,6-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 134986557) has the molecular formula C10H6ClFN4 and a molecular weight of 236.64 g/mol. Its IUPAC name is (2-chloro-4-cyanoimino-5-fluoro-3,6-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (2-chloro-4-cyanoimino-5-fluoro-3,6-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 134986557 |
| Molecular Formula | C10H6ClFN4 |
| Molecular Weight | 236.64 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (2-chloro-4-cyanoimino-5-fluoro-3,6-dimethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CC1=C(F)/C(=N/C#N)C(C)=C(Cl)/C1=N/C#N |
| InChI | InChI=1S/C10H6ClFN4/c1-5-7(11)9(15-3-13)6(2)8(12)10(5)16-4-14/h1-2H3/b15-9+,16-10+ |
| InChIKey | HNLGLAXZOFOOCP-KAVGSWPWSA-N |
| XLogP | 2.60 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|