C13H13ClN4 — CID 134937212
(2-chloro-4-cyanoimino-5,6-diethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 134937212) has the molecular formula C13H13ClN4 and a molecular weight of 260.73 g/mol. Its IUPAC name is (2-chloro-4-cyanoimino-5,6-diethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (2-chloro-4-cyanoimino-5,6-diethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 134937212 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2-chloro-4-cyanoimino-5,6-diethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CCC1=C(CC)/C(=N/C#N)C(Cl)=C(C)/C1=N\C#N |
| InChI | InChI=1S/C13H13ClN4/c1-4-9-10(5-2)13(18-7-16)11(14)8(3)12(9)17-6-15/h4-5H2,1-3H3/b17-12+,18-13- |
| InChIKey | YDIHUBPLEPIUDZ-HUPOLGGESA-N |
| XLogP | 3.47 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|