C12H22O4S2 — CID 134986656
5-O-ethyl 1-O-methyl 4-ethyl-2,2-bis(methylsulfanyl)pentanedioate (PubChem CID 134986656) has the molecular formula C12H22O4S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl 4-ethyl-2,2-bis(methylsulfanyl)pentanedioate.
| Compound Name | 5-O-ethyl 1-O-methyl 4-ethyl-2,2-bis(methylsulfanyl)pentanedioate |
|---|---|
| PubChem CID | 134986656 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-O-ethyl 1-O-methyl 4-ethyl-2,2-bis(methylsulfanyl)pentanedioate |
| SMILES | CCOC(=O)C(CC)CC(SC)(SC)C(=O)OC |
| InChI | InChI=1S/C12H22O4S2/c1-6-9(10(13)16-7-2)8-12(17-4,18-5)11(14)15-3/h9H,6-8H2,1-5H3 |
| InChIKey | FSYBFSYCUQWCGX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|