C11H13N5O2 — CID 134987352
methyl 2-cyano-3,3-bis(2-cyanoethylamino)prop-2-enoate (PubChem CID 134987352) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is methyl 2-cyano-3,3-bis(2-cyanoethylamino)prop-2-enoate.
| Compound Name | methyl 2-cyano-3,3-bis(2-cyanoethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 134987352 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | methyl 2-cyano-3,3-bis(2-cyanoethylamino)prop-2-enoate |
| SMILES | COC(=O)C(C#N)=C(NCCC#N)NCCC#N |
| InChI | InChI=1S/C11H13N5O2/c1-18-11(17)9(8-14)10(15-6-2-4-12)16-7-3-5-13/h15-16H,2-3,6-7H2,1H3 |
| InChIKey | AWZWSKYSRUWJDK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|