C7H10F3NO2S — CID 134987468
N-butyl-N-ethynyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 134987468) has the molecular formula C7H10F3NO2S and a molecular weight of 229.22 g/mol. Its IUPAC name is N-butyl-N-ethynyl-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-butyl-N-ethynyl-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 134987468 |
| Molecular Formula | C7H10F3NO2S |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | N-butyl-N-ethynyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | C#CN(CCCC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO2S/c1-3-5-6-11(4-2)14(12,13)7(8,9)10/h2H,3,5-6H2,1H3 |
| InChIKey | YJYVCAIIIHUIDS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|