C7H14F3NO2S — CID 63932239
N-butyl-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 63932239) has the molecular formula C7H14F3NO2S and a molecular weight of 233.25 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 63932239 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C7H14F3NO2S/c1-3-4-5-11(14(2,12)13)6-7(8,9)10/h3-6H2,1-2H3 |
| InChIKey | HAIYVDXFTJWGKG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |