C10H12O7 — CID 134987506
[(1R,2R)-3-oxo-1-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2-prop-2-enoxypropyl] formate (PubChem CID 134987506) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is [(1R,2R)-3-oxo-1-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2-prop-2-enoxypropyl] formate.
| Compound Name | [(1R,2R)-3-oxo-1-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2-prop-2-enoxypropyl] formate |
|---|---|
| PubChem CID | 134987506 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | [(1R,2R)-3-oxo-1-[(4R)-2-oxo-1,3-dioxolan-4-yl]-2-prop-2-enoxypropyl] formate |
| SMILES | C=CCO[C@@H](C=O)[C@H](OC=O)[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C10H12O7/c1-2-3-14-7(4-11)9(16-6-12)8-5-15-10(13)17-8/h2,4,6-9H,1,3,5H2/t7-,8+,9-/m0/s1 |
| InChIKey | SWOWKEIPPIPIFD-YIZRAAEISA-N |
| XLogP | -0.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|