C9H14O2S2 — CID 134988590
ethyl 6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134988590) has the molecular formula C9H14O2S2 and a molecular weight of 218.34 g/mol. Its IUPAC name is ethyl 6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134988590 |
| Molecular Formula | C9H14O2S2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | ethyl 6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1(SC)CC=CCS1 |
| InChI | InChI=1S/C9H14O2S2/c1-3-11-8(10)9(12-2)6-4-5-7-13-9/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | HGWNOICXWCTMHV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|