C10H16O2S2 — CID 134917839
ethyl 3-methyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134917839) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethyl 3-methyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 3-methyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134917839 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | ethyl 3-methyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1(SC)CC=C(C)CS1 |
| InChI | InChI=1S/C10H16O2S2/c1-4-12-9(11)10(13-3)6-5-8(2)7-14-10/h5H,4,6-7H2,1-3H3 |
| InChIKey | CFJRKEPAZRXWSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|