C11H18O2S2 — CID 102048248
ethyl (6S)-3,4-dimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 102048248) has the molecular formula C11H18O2S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is ethyl (6S)-3,4-dimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl (6S)-3,4-dimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 102048248 |
| Molecular Formula | C11H18O2S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | ethyl (6S)-3,4-dimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)[C@]1(SC)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C11H18O2S2/c1-5-13-10(12)11(14-4)6-8(2)9(3)7-15-11/h5-7H2,1-4H3/t11-/m0/s1 |
| InChIKey | GTAXFMQTSFRSCB-NSHDSACASA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|