C12H18O4S2 — CID 15180554
methyl 6-(2-methoxy-2-oxoethyl)sulfanyl-3,4-dimethyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 15180554) has the molecular formula C12H18O4S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is methyl 6-(2-methoxy-2-oxoethyl)sulfanyl-3,4-dimethyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | methyl 6-(2-methoxy-2-oxoethyl)sulfanyl-3,4-dimethyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 15180554 |
| Molecular Formula | C12H18O4S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl 6-(2-methoxy-2-oxoethyl)sulfanyl-3,4-dimethyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | COC(=O)CSC1(C(=O)OC)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C12H18O4S2/c1-8-5-12(11(14)16-4,17-6-9(8)2)18-7-10(13)15-3/h5-7H2,1-4H3 |
| InChIKey | HFCPPWKZAOVVOO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|