C12H20O2S2 — CID 134988955
ethyl 2,3,4-trimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134988955) has the molecular formula C12H20O2S2 and a molecular weight of 260.42 g/mol. Its IUPAC name is ethyl 2,3,4-trimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 2,3,4-trimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134988955 |
| Molecular Formula | C12H20O2S2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | ethyl 2,3,4-trimethyl-6-methylsulfanyl-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1(SC)CC(C)=C(C)C(C)S1 |
| InChI | InChI=1S/C12H20O2S2/c1-6-14-11(13)12(15-5)7-8(2)9(3)10(4)16-12/h10H,6-7H2,1-5H3 |
| InChIKey | MPZHYKHNPFTXKJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|