C9H14O2S — CID 11041461
methyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate (PubChem CID 11041461) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is methyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate.
| Compound Name | methyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
|---|---|
| PubChem CID | 11041461 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | methyl 4,5-dimethyl-3,6-dihydro-2H-thiopyran-2-carboxylate |
| SMILES | COC(=O)C1CC(C)=C(C)CS1 |
| InChI | InChI=1S/C9H14O2S/c1-6-4-8(9(10)11-3)12-5-7(6)2/h8H,4-5H2,1-3H3 |
| InChIKey | LZLVVYNJOCBWKV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|