C21H26N2O2 — CID 134990524
2-(3,4-dimethoxyphenyl)-2-(dimethylamino)-5-phenylpentanenitrile (PubChem CID 134990524) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-(dimethylamino)-5-phenylpentanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-(dimethylamino)-5-phenylpentanenitrile |
|---|---|
| PubChem CID | 134990524 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-(dimethylamino)-5-phenylpentanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCc2ccccc2)N(C)C)cc1OC |
| InChI | InChI=1S/C21H26N2O2/c1-23(2)21(16-22,14-8-11-17-9-6-5-7-10-17)18-12-13-19(24-3)20(15-18)25-4/h5-7,9-10,12-13,15H,8,11,14H2,1-4H3 |
| InChIKey | DZFUEEMIRKNLLQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |