C18H20N2O4Pd — CID 134991111
acetic acid;2,9-dimethyl-1,10-phenanthroline;palladium (PubChem CID 134991111) has the molecular formula C18H20N2O4Pd and a molecular weight of 434.79 g/mol. Its IUPAC name is acetic acid;2,9-dimethyl-1,10-phenanthroline;palladium.
| Compound Name | acetic acid;2,9-dimethyl-1,10-phenanthroline;palladium |
|---|---|
| PubChem CID | 134991111 |
| Molecular Formula | C18H20N2O4Pd |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | acetic acid;2,9-dimethyl-1,10-phenanthroline;palladium |
| SMILES | CC(=O)O.CC(=O)O.Cc1ccc2ccc3ccc(C)nc3c2n1.[Pd] |
| InChI | InChI=1S/C14H12N2.2C2H4O2.Pd/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*1-2(3)4;/h3-8H,1-2H3;2*1H3,(H,3,4); |
| InChIKey | KKPSVWFPLZVUSZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|