C24H24ClCuO4P2 — CID 134991287
copper(1+);[1-(2-dimethylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-dimethylphosphane;perchlorate (PubChem CID 134991287) has the molecular formula C24H24ClCuO4P2 and a molecular weight of 537.40 g/mol. Its IUPAC name is copper(1+);[1-(2-dimethylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-dimethylphosphane;perchlorate.
| Compound Name | copper(1+);[1-(2-dimethylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-dimethylphosphane;perchlorate |
|---|---|
| PubChem CID | 134991287 |
| Molecular Formula | C24H24ClCuO4P2 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | copper(1+);[1-(2-dimethylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-dimethylphosphane;perchlorate |
| SMILES | CP(C)c1ccc2ccccc2c1-c1c(P(C)C)ccc2ccccc12.[Cu+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H24P2.ClHO4.Cu/c1-25(2)21-15-13-17-9-5-7-11-19(17)23(21)24-20-12-8-6-10-18(20)14-16-22(24)26(3)4;2-1(3,4)5;/h5-16H,1-4H3;(H,2,3,4,5);/q;;+1/p-1 |
| InChIKey | GBYCISKVNMDUHT-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|