C21H23NO2S — CID 13499146
N-[2-(3,3-dimethyl-5-oxocyclohexyl)sulfanylphenyl]benzamide (PubChem CID 13499146) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[2-(3,3-dimethyl-5-oxocyclohexyl)sulfanylphenyl]benzamide.
| Compound Name | N-[2-(3,3-dimethyl-5-oxocyclohexyl)sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 13499146 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[2-(3,3-dimethyl-5-oxocyclohexyl)sulfanylphenyl]benzamide |
| SMILES | CC1(C)CC(=O)CC(Sc2ccccc2NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO2S/c1-21(2)13-16(23)12-17(14-21)25-19-11-7-6-10-18(19)22-20(24)15-8-4-3-5-9-15/h3-11,17H,12-14H2,1-2H3,(H,22,24) |
| InChIKey | LDVNHMXTVMRLBL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |