C19H20FNO2S — CID 31915342
N-(2-cyclopentylsulfanylphenyl)-3-fluoro-4-methoxybenzamide (PubChem CID 31915342) has the molecular formula C19H20FNO2S and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-3-fluoro-4-methoxybenzamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 31915342 |
| Molecular Formula | C19H20FNO2S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2SC2CCCC2)cc1F |
| InChI | InChI=1S/C19H20FNO2S/c1-23-17-11-10-13(12-15(17)20)19(22)21-16-8-4-5-9-18(16)24-14-6-2-3-7-14/h4-5,8-12,14H,2-3,6-7H2,1H3,(H,21,22) |
| InChIKey | SFKNPRLKJSWTMW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |