C19H21N3O4S — CID 119050823
1-(2-cyclopentylsulfanylphenyl)-3-[(3,4-dihydroxybenzoyl)amino]urea (PubChem CID 119050823) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-(2-cyclopentylsulfanylphenyl)-3-[(3,4-dihydroxybenzoyl)amino]urea.
| Compound Name | 1-(2-cyclopentylsulfanylphenyl)-3-[(3,4-dihydroxybenzoyl)amino]urea |
|---|---|
| PubChem CID | 119050823 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(2-cyclopentylsulfanylphenyl)-3-[(3,4-dihydroxybenzoyl)amino]urea |
| SMILES | O=C(NNC(=O)c1ccc(O)c(O)c1)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C19H21N3O4S/c23-15-10-9-12(11-16(15)24)18(25)21-22-19(26)20-14-7-3-4-8-17(14)27-13-5-1-2-6-13/h3-4,7-11,13,23-24H,1-2,5-6H2,(H,21,25)(H2,20,22,26) |
| InChIKey | HIHHKEUZYHDICR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|