C15H13FN2O2S — CID 62919051
N-(2-carbamothioylphenyl)-3-fluoro-4-methoxybenzamide (PubChem CID 62919051) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-3-fluoro-4-methoxybenzamide.
| Compound Name | N-(2-carbamothioylphenyl)-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 62919051 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-(2-carbamothioylphenyl)-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(N)=S)cc1F |
| InChI | InChI=1S/C15H13FN2O2S/c1-20-13-7-6-9(8-11(13)16)15(19)18-12-5-3-2-4-10(12)14(17)21/h2-8H,1H3,(H2,17,21)(H,18,19) |
| InChIKey | KWXDRFWYNCWYNQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|