About CID 134991817
CID 134991817 (PubChem CID 134991817) has the molecular formula C21H18Cl2Zr
and a molecular weight of 432.51 g/mol.
Molecular Properties
| Compound Name | CID 134991817 |
| PubChem CID | 134991817 |
| Molecular Formula | C21H18Cl2Zr |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | — |
| SMILES | CC(C)([C]1[CH][CH][C]2C=CC=C[C]21)[C]1[CH][CH][C]2C=CC=C[C]21.Cl[Zr]Cl |
| InChI | InChI=1S/C21H18.2ClH.Zr/c1-21(2,19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20;;;/h3-14H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MAATUOURWPBUMY-UHFFFAOYSA-L |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134991817 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134991817?
The IUPAC name of CID 134991817 (CID 134991817) is not available.
What is the SMILES notation for CID 134991817?
The canonical SMILES for CID 134991817 is CC(C)([C]1[CH][CH][C]2C=CC=C[C]21)[C]1[CH][CH][C]2C=CC=C[C]21.Cl[Zr]Cl.
What is the InChIKey of CID 134991817?
The InChIKey is MAATUOURWPBUMY-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H18.2ClH.Zr/c1-21(2,19-13-11-15-7-3-5-9-17(15)19)20-14-12-16-8-4-6-10-18(16)20;;;/h3-14H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 134991817?
CID 134991817 has a molecular weight of 432.51 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134991817 is sourced from PubChem (CID 134991817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).